38898-02-1 Usage
Description
(2E)-3-5-[(ACETYLOXY)METHYL]-2-FURYLACRYLIC ACID is a chemical compound with the molecular formula C11H10O6. It is a derivative of acrylic acid, with an acetyloxy group attached to the fifth carbon of a furan ring. (2E)-3-5-[(ACETYLOXY)METHYL]-2-FURYLACRYLIC ACID is synthesized through the reaction of acetic anhydride with 2-furoic acid and is often used as a starting material in organic synthesis. The acetyloxy group can undergo hydrolysis, forming a carboxylic acid group, making this compound useful in the preparation of various organic compounds. It also has potential applications in pharmaceuticals and agrochemicals due to its unique structure and reactivity.
Uses
Used in Organic Synthesis:
(2E)-3-5-[(ACETYLOXY)METHYL]-2-FURYLACRYLIC ACID is used as a starting material for the synthesis of various organic compounds. Its acetyloxy group can undergo hydrolysis, forming a carboxylic acid group, which allows for further reactions and the creation of a wide range of chemical products.
Used in Pharmaceutical Industry:
(2E)-3-5-[(ACETYLOXY)METHYL]-2-FURYLACRYLIC ACID is used as a building block in the development of pharmaceuticals. Its unique structure and reactivity make it a promising candidate for the synthesis of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
(2E)-3-5-[(ACETYLOXY)METHYL]-2-FURYLACRYLIC ACID is used in the development of agrochemicals, such as pesticides and herbicides. Its chemical properties and reactivity contribute to the creation of effective and targeted agricultural products.
Check Digit Verification of cas no
The CAS Registry Mumber 38898-02-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,8,9 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 38898-02:
(7*3)+(6*8)+(5*8)+(4*9)+(3*8)+(2*0)+(1*2)=171
171 % 10 = 1
So 38898-02-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O5/c1-7(11)14-6-9-3-2-8(15-9)4-5-10(12)13/h2-5H,6H2,1H3,(H,12,13)/b5-4+