3916-64-1 Usage
Description
2,4-Heptadien-6-one, with the molecular formula C7H8O and a molecular weight of 108.14 g/mol, is a 7-carbon saturated and unsaturated ketone featuring two conjugated double bonds in its carbon chain. This yellow liquid at room temperature is recognized for its distinctive fragrance, making it a valuable component in various industries.
Uses
Used in Fragrance Industry:
2,4-Heptadien-6-one is utilized as a fragrance ingredient for its aromatic properties, playing a crucial role in the manufacturing of perfumes and other personal care products. Its unique scent profile contributes to the creation of diverse and appealing fragrances that cater to consumer preferences.
Used in Food Industry:
In the food industry, 2,4-heptadien-6-one serves as a flavoring agent, enhancing the taste and aroma of various food products. Its ability to impart specific flavor notes makes it a valuable addition in the development of food formulations.
Used as a Chemical Intermediate:
2,4-Heptadien-6-one also functions as a chemical intermediate in the synthesis of other organic compounds. Its chemical structure allows for further reactions and modifications, making it a versatile building block for creating a wide range of chemical products.
Used in Pharmaceutical and Agrochemical Production:
Furthermore, 2,4-heptadien-6-one has potential applications as a chemical building block in the production of pharmaceuticals and agrochemicals. Its presence in these industries highlights its utility in developing new and innovative products that address various needs.
Check Digit Verification of cas no
The CAS Registry Mumber 3916-64-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,9,1 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3916-64:
(6*3)+(5*9)+(4*1)+(3*6)+(2*6)+(1*4)=101
101 % 10 = 1
So 3916-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O/c1-3-4-5-6-7(2)8/h3-6H,1-2H3/b4-3+,6-5+
3916-64-1Relevant articles and documents
Br?nsted Base Catalyzed One-Pot Synthesis of Stereodefined Six-Member Carbocycles Featuring Transient Trienolates and a Key Intramolecular 1,6-Addition
Olaizola, Olatz,Iriarte, Igor,Zanella, Giovanna,Gómez-Bengoa, Enrique,Ganboa, I?aki,Oiarbide, Mikel,Palomo, Claudio
supporting information, p. 14250 - 14254 (2019/09/13)
A catalyst-driven one-pot reaction sequence is developed for the enantio- and diastereoselective synthesis of tetrasubstituted cyclohexenes from simple unsaturated ketones or thioesters. The method involves a tertiary amine/squaramide-catalyzed α-selective addition of transiently generated trienolates to nitroolefins, subsequent base-catalyzed double bond isomerization, and an intramolecular (vinylogous) 1,6-addition reaction, a rare key carbocyclization step that proceeded with essentially perfect stereocontrol.
