3952-42-9 Usage
Description
9-N-Butylfluorene is an organic compound that serves as a crucial intermediate in the synthesis of various chemical compounds. It is characterized by its unique molecular structure, which includes a fluorene backbone with a butyl group attached to the nitrogen atom.
Uses
Used in Chemical Synthesis:
9-N-Butylfluorene is used as a reagent or intermediate for the synthesis of selenium-containing esters. Its unique structure allows for the formation of selenol esters, which have potential applications in various fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 9-N-Butylfluorene is utilized in the preparation of bifluorenes, such as T291200. Bifluorenes are complex organic molecules with potential applications in the development of new drugs and therapeutic agents.
Used in Material Science:
9-N-Butylfluorene's role in the synthesis of bifluorenes also extends to material science, where these complex molecules can be used to create novel materials with unique properties, such as improved conductivity or enhanced stability.
Overall, 9-N-Butylfluorene is a versatile compound with applications in various industries, including pharmaceuticals, chemical synthesis, and material science, due to its ability to act as a reagent or intermediate in the synthesis of selenium-containing esters and bifluorenes.
Check Digit Verification of cas no
The CAS Registry Mumber 3952-42-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,9,5 and 2 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 3952-42:
(6*3)+(5*9)+(4*5)+(3*2)+(2*4)+(1*2)=99
99 % 10 = 9
So 3952-42-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H18/c1-2-3-8-13-14-9-4-6-11-16(14)17-12-7-5-10-15(13)17/h4-7,9-13H,2-3,8H2,1H3
3952-42-9Relevant articles and documents
UNEXPECTED PRODUCTS IN A KABACHNIK-FIELDS SYNTHESIS OF AMINOPHOSPHONATES
Gancarz, Roman
, p. 59 - 64 (2007/10/02)
In a Kabachnik-Fields synthesis of aminophosphonates derived from aromatic ketones the formation of hydroxyphosphonates, their rearrangement to corresponding phosphates and amine promoted decomposition of the last, leads to a number of unexpected products, which in some cases could be the only products of reaction.Key words: 1-Aminophosphonates; 1-hydroxyphosphonates; Kabachnik-Fields reaction; phosphonate-phosphate rearrangement.
