4030-51-7 Usage
General Description
Cassyfiline is a chemical compound found in the Cassytha filiformis plant, also known as love vine or strangleweed. It is a natural product with potential pharmaceutical and medicinal applications. Studies have shown that cassyfiline exhibits anti-inflammatory, antifungal, and antioxidant properties, making it a promising candidate for the development of new drugs for various health conditions. Additionally, cassyfiline has been found to have inhibitory effects on the growth of cancer cells, indicating its potential role in cancer treatment. Overall, cassyfiline's diverse biological activities make it a valuable compound for further exploration and potential therapeutic use.
Check Digit Verification of cas no
The CAS Registry Mumber 4030-51-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,3 and 0 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4030-51:
(6*4)+(5*0)+(4*3)+(3*0)+(2*5)+(1*1)=47
47 % 10 = 7
So 4030-51-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO5/c1-22-14-7-11-9(6-13(14)21)5-12-15-10(3-4-20-12)17(23-2)19-18(16(11)15)24-8-25-19/h6-7,12,20-21H,3-5,8H2,1-2H3/t12-/m0/s1