40442-42-0 Usage
Description
(2E,4E)-2-(1,3-Benzothiazol-2-yl)-5-[4-(dimethylamino)phenyl]penta-2,4-dienenitrile is a complex organic molecule that belongs to the class of penta-2,4-dienitriles. It features a chain of five carbon atoms with multiple double bonds and nitrile functional groups. Additionally, the compound incorporates a benzothiazole ring and a dimethylamino group, which may contribute to its chemical and potential biological activities. Further research and testing are required to determine its specific properties and possible applications.
Uses
As the specific uses of (2E,4E)-2-(1,3-Benzothiazol-2-yl)-5-[4-(dimethylamino)phenyl]penta-2,4-dienenitrile are not provided in the materials, it is not possible to list its applications according to the given instructions. However, given its complex structure and the presence of various functional groups, it is plausible that this compound could have potential uses in various industries such as pharmaceuticals, materials science, or as an intermediate in the synthesis of other organic compounds. Further investigation would be necessary to confirm its practical applications and benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 40442-42-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,4,4 and 2 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 40442-42:
(7*4)+(6*0)+(5*4)+(4*4)+(3*2)+(2*4)+(1*2)=80
80 % 10 = 0
So 40442-42-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H17N3S/c1-23(2)17-12-10-15(11-13-17)6-5-7-16(14-21)20-22-18-8-3-4-9-19(18)24-20/h3-13H,1-2H3/b6-5+,16-7+
40442-42-0Relevant articles and documents
A benzothiazole 2 - acetonitrile and application thereof
-
Paragraph 0010; 0023-0025, (2019/05/11)
The invention relates to a benzothiazole 2 - acetonitrile, the following chemical structure (I) is shown. The invention of the benzothiazole 2 - acetonitrile by 4 - dimethyl amino cinnamic aldehyde with the benzothiazole - 2 - acetonitrile reaction. The i