40756-70-5 Usage
General Description
3-(1H-INDOL-2-YL)-PHENOL, also known as indolylphenol, is a chemical compound with a molecular formula C14H11NO. It is a derivative of indole and phenol, and is commonly used in organic synthesis and pharmaceutical research. Indolylphenol has been found to have potential pharmacological activities, including anti-inflammatory and anti-cancer properties, making it a subject of interest for drug development. Its unique structure and functional groups make it a versatile building block for the synthesis of various organic compounds and complex molecules. However, its potential toxicity and environmental impact should be carefully considered in its use and handling.
Check Digit Verification of cas no
The CAS Registry Mumber 40756-70-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,7,5 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 40756-70:
(7*4)+(6*0)+(5*7)+(4*5)+(3*6)+(2*7)+(1*0)=115
115 % 10 = 5
So 40756-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H11NO/c16-12-6-3-5-10(8-12)14-9-11-4-1-2-7-13(11)15-14/h1-9,15-16H
