411235-57-9 Usage
Description
Cyclopropylboronic acid is an organoboronic acid that exists as a white to off-white powder. It is a versatile reagent widely utilized in various chemical reactions and synthesis processes due to its unique chemical properties.
Uses
1. Used in Pharmaceutical Industry:
Cyclopropylboronic acid is used as a reagent for the synthesis of various pharmaceutical compounds, particularly in the preparation of diaryl ketones by arylation. Its application in this industry is due to its ability to facilitate the formation of carbon-carbon bonds, which are essential in the creation of complex molecular structures.
2. Used in Chemical Synthesis:
Cyclopropylboronic acid is used as a reagent in several chemical reactions, including the Suzuki reaction, a highly efficient method for the formation of carbon-carbon bonds. This reaction is particularly useful in the synthesis of complex organic molecules and has applications in various fields, such as materials science and pharmaceuticals.
3. Used in Microwave-assisted Copper(II)-catalyzed N-cyclopropylation:
Cyclopropylboronic acid is used as a reagent in this specific reaction, which is a method for the introduction of a cyclopropyl group onto a nitrogen atom in a molecule. This application is valuable for the synthesis of various organic compounds, including those with potential pharmaceutical or chemical applications.
4. Used in Nickeland Copper-catalyzed Suzuki-Miyaura coupling reaction of arenes:
Cyclopropylboronic acid is used as a reagent in this reaction, which is a variant of the Suzuki reaction that involves the coupling of arenes (aromatic hydrocarbons) with other organic molecules. This reaction is useful for the synthesis of a wide range of organic compounds, including those with potential applications in various industries.
5. Used in Palladacycle-catalyzed Suzuki-cross coupling of aryl halides:
Cyclopropylboronic acid is used as a reagent in this reaction, which is a specific type of Suzuki coupling that involves the use of a palladacycle catalyst. This reaction is particularly useful for the synthesis of complex organic molecules, such as those found in pharmaceuticals and other specialty chemicals.
6. Used in Palladium(0)-catalyzed cyclopropane C-H bond functionalization:
Cyclopropylboronic acid is used as a reagent in this reaction, which involves the functionalization of a cyclopropane's C-H bond using a palladium(0) catalyst. This reaction is valuable for the synthesis of various organic compounds, including those with potential applications in the pharmaceutical and chemical industries.
7. Used in Palladium-catalyzed decarboxylative coupling:
Cyclopropylboronic acid is used as a reagent in this reaction, which involves the coupling of a carboxylic acid with another organic molecule in the presence of a palladium catalyst. This reaction is useful for the synthesis of a wide range of organic compounds, including those with potential applications in various industries.
8. Used in Palladium-catalyzed ligand-directed oxidative functionalization of cyclopropanes:
Cyclopropylboronic acid is used as a reagent in this reaction, which involves the selective functionalization of a cyclopropane's C-H bond using a palladium catalyst and a directing ligand. This reaction is valuable for the synthesis of various organic compounds, including those with potential applications in the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 411235-57-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,1,2,3 and 5 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 411235-57:
(8*4)+(7*1)+(6*1)+(5*2)+(4*3)+(3*5)+(2*5)+(1*7)=99
99 % 10 = 9
So 411235-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H7BO2/c5-4(6)3-1-2-3/h3,5-6H,1-2H2
411235-57-9Relevant articles and documents
2-amino-5-heteroaryl substituted pyrazine derivative and application thereof
-
Paragraph 0077-0078; 0080, (2021/05/29)
The invention provides a 2-amino-5-heteroaryl substituted pyrazine derivative with a chemical structure as shown in a formula 1, a pharmaceutical preparation containing the 2-amino-5-heteroaryl substituted pyrazine derivative, and application of the 2-amino-5-heteroaryl substituted pyrazine derivative in drugs for treating or preventing malaria. Compared with the prior art, the compound has the effects of resisting plasmodium falciparum proliferation and resisting plasmodium falciparum of different strains, and has the advantages of longer half-life period, lower plasma clearance rate, higher distribution volume and better oral bioavailability.
Synthesis method of cyclopropyl boric acid
-
Paragraph 0016; 0017; 0018; 0019, (2019/02/19)
The invention discloses a synthesis method of cyclopropyl boric acid, and belongs to the field of boric acid synthesis in organic chemistry. The synthesis method comprises the following steps: starting from formyl boric acid, enabling the formyl boric acid with strong electron-withdrawing sulfohydrazide to generate hydrazone, then introducing ethylene under the catalysis of ferriporphyrin, and reacting, thus obtaining the cyclopropyl boric acid. The synthesis method disclosed by the invention is simple in operation, the use of cyclopropyl bromide in a traditional technological method is avoided by adopting cyclopropanation reaction under metal catalysis, and a new synthesis path is provided for synthesis of the cyclopropyl boric acid.
A process for the preparation method of the cyclopropyl-boronic acid
-
Paragraph 0026; 0027; 0033; 0034; 0040; 0041, (2017/06/30)
The invention discloses a method for preparing cyclopropyl boronic acid. Cyclopropyl methanoic acid is adopted as a raw material and added into a solution obtained after n-butyllithium reacts with organic alkali at the low temperature, and then a boronizing reagent is added into the mixture; after boronation is finished, acid is added for quenching to obtain 1-carboxyl cyclopropyl boronic acid; the intermediate is added into high-boiling-point solvent and heated until the temperature is 80 DEG C-150 DEG C, after reaction deacidification, methylbenzene is added into the mixed solution for dehydration to form cyclopropyl boronic acid trimer, and the cyclopropyl boronic acid trimer is hydrolyzed to obtain the cyclopropyl boronic acid; the melting point of the obtained cyclopropyl boronic acid is 90 DEG C-95 DEG C, and the HNMR purity of the obtained cyclopropyl boronic acid is over 98%. The method is easy to operate and suitable for industrial scale-up production, and no highly toxic chemical is used in the whole process.