41388-04-9 Usage
Description
[2-[3-[3-heptyl-1,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-4-ylidene]-1-propenyl]phenoxy]acetic acid is a complex organic compound featuring a phenoxyacetic acid core with a heptyl chain, a trichlorophenyl group, and a pyrazol-4-ylidene moiety. The combination of these functional groups suggests potential applications in medicinal chemistry, possibly for the development of pharmaceuticals that target specific biological pathways or receptors. The presence of a long hydrocarbon chain may also confer amphiphilic properties, enabling interaction with both hydrophobic and hydrophilic environments.
Uses
Used in Pharmaceutical Development:
[2-[3-[3-heptyl-1,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-4-ylidene]-1-propenyl]phenoxy]acetic acid is used as a potential pharmaceutical agent for targeting specific biological pathways or receptors due to its unique structural features and the presence of diverse functional groups.
Used in Medicinal Chemistry Research:
[2-[3-[3-heptyl-1,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-4-ylidene]-1-propenyl]phenoxy]acetic acid is used as a research tool in medicinal chemistry to explore its interactions with biological systems, potentially leading to the discovery of new therapeutic agents or a better understanding of certain disease mechanisms.
Used in Drug Delivery Systems:
Given its amphiphilic nature, [2-[3-[3-heptyl-1,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-4-ylidene]-1-propenyl]phenoxy]acetic acid could be utilized in the design of drug delivery systems, particularly for improving the solubility and bioavailability of hydrophobic drugs.
Used in Chemical Synthesis:
[2-[3-[3-heptyl-1,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-4-ylidene]-1-propenyl]phenoxy]acetic acid may also find use in chemical synthesis as a building block or intermediate for creating more complex molecules with specific applications in various industries, including materials science, agrochemicals, and specialty chemicals.
Used in the Chemical Industry:
In the chemical industry, [2-[3-[3-heptyl-1,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-4-ylidene]-1-propenyl]phenoxy]acetic acid could be employed as a specialty chemical with tailored properties for specific applications, such as in the development of new materials or coatings with unique characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 41388-04-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,3,8 and 8 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 41388-04:
(7*4)+(6*1)+(5*3)+(4*8)+(3*8)+(2*0)+(1*4)=109
109 % 10 = 9
So 41388-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C27H27Cl3N2O4/c1-2-3-4-5-6-13-23-20(12-9-11-18-10-7-8-14-24(18)36-17-25(33)34)27(35)32(31-23)26-21(29)15-19(28)16-22(26)30/h7-12,14-16H,2-6,13,17H2,1H3,(H,33,34)/b11-9+,20-12-