41731-33-3 Usage
Description
2-bromothiazol-4-amine is an organic compound characterized by its bromine atom and thiazol ring structure. It is a versatile building block in the synthesis of various chemical compounds and materials due to its unique chemical properties.
Uses
Used in Chemical Synthesis:
2-bromothiazol-4-amine is used as a synthetic intermediate for the preparation of electron-deficient-type and electron-deficient conjugated extended Isoindigo compounds. Its reactivity and structural features make it a valuable component in the development of advanced materials with potential applications in various industries, such as electronics, pharmaceuticals, and materials science.
In the context of the provided materials, 2-bromothiazol-4-amine serves as a key component in the synthesis of specific types of Isoindigo compounds, which are known for their unique electronic properties and potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 41731-33-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,7,3 and 1 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 41731-33:
(7*4)+(6*1)+(5*7)+(4*3)+(3*1)+(2*3)+(1*3)=93
93 % 10 = 3
So 41731-33-3 is a valid CAS Registry Number.
InChI:InChI=1/C3H3BrN2S/c4-3-6-2(5)1-7-3/h1H,5H2