4207-42-5 Usage
Allantoin
1. Soothing properties: helps to calm and alleviate skin irritations
2. Anti-irritant properties: reduces inflammation and redness on the skin
3. Keratolytic properties: aids in exfoliating and removing dead skin cells
4. Used for skin healing and regeneration
5. Found in plants like comfrey and sugar beet
PABA (Para-aminobenzoic acid)
1. UV protection: absorbs ultraviolet (UV) rays to prevent sunburn and skin damage
2. Found in sunscreen products
3. Used in hair dyes: maintains color and luster of hair
4. Widely used in personal care and cosmetic products
Both allantoin and PABA
1. Valued for their beneficial effects on skin and hair
2. Commonly used in skincare and cosmetic products
Check Digit Verification of cas no
The CAS Registry Mumber 4207-42-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,2,0 and 7 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4207-42:
(6*4)+(5*2)+(4*0)+(3*7)+(2*4)+(1*2)=65
65 % 10 = 5
So 4207-42-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO2.C4H6N4O3/c8-6-3-1-5(2-4-6)7(9)10;5-3(10)6-1-2(9)8-4(11)7-1/h1-4H,8H2,(H,9,10);1H,(H3,5,6,10)(H2,7,8,9,11)
