42136-05-0 Usage
Description
2-Acetyl-9H-fluoren-9-one is a chemical compound with the molecular formula C17H12O2. It is a ketone derivative of fluorene, a polycyclic aromatic hydrocarbon. 2-ACETYL-9H-FLUOREN-9-ONE has a yellow crystalline appearance and is insoluble in water but soluble in organic solvents. It is commonly used as a building block in organic chemistry and has potential applications in the manufacturing of dyes, pharmaceuticals, and other industrial products. However, it may pose health risks if inhaled, ingested, or in contact with skin, and appropriate safety precautions should be taken when handling it.
Uses
Used in Organic Chemistry:
2-Acetyl-9H-fluoren-9-one is used as a building block in organic chemistry for the synthesis of various organic compounds. Its unique structure and reactivity make it a valuable intermediate in the preparation of complex organic molecules.
Used in Dye Manufacturing:
2-Acetyl-9H-fluoren-9-one is used as a starting material in the manufacturing of dyes. Its aromatic structure and functional groups allow for the development of dyes with specific color properties and stability.
Used in Pharmaceutical Industry:
2-Acetyl-9H-fluoren-9-one is used as a key intermediate in the synthesis of pharmaceuticals. Its versatile chemical properties enable the production of various drug molecules with potential therapeutic applications.
Used in Other Industrial Products:
2-Acetyl-9H-fluoren-9-one has potential applications in the manufacturing of other industrial products, such as polymers and specialty chemicals. Its unique properties and reactivity contribute to the development of innovative materials and products.
Check Digit Verification of cas no
The CAS Registry Mumber 42136-05-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,1,3 and 6 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 42136-05:
(7*4)+(6*2)+(5*1)+(4*3)+(3*6)+(2*0)+(1*5)=80
80 % 10 = 0
So 42136-05-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H10O2/c1-9(16)10-6-7-12-11-4-2-3-5-13(11)15(17)14(12)8-10/h2-8H,1H3