42155-93-1 Usage
General Description
H-GLU-GLY-PHE-OH is a peptide compound consisting of the amino acids glutamic acid (GLU), glycine (GLY), and phenylalanine (PHE) connected in a specific sequence. These amino acids are the building blocks of proteins and play a crucial role in various biological processes. Glutamic acid is an important neurotransmitter and is involved in the functioning of the nervous system. Glycine is the simplest of the amino acids and is essential for the synthesis of proteins and the regulation of numerous bodily functions. Phenylalanine is an essential amino acid that the body cannot produce on its own and must be obtained through the diet. H-GLU-GLY-PHE-OH may have potential applications in pharmaceuticals, research, and various biological studies.
Check Digit Verification of cas no
The CAS Registry Mumber 42155-93-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,1,5 and 5 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 42155-93:
(7*4)+(6*2)+(5*1)+(4*5)+(3*5)+(2*9)+(1*3)=101
101 % 10 = 1
So 42155-93-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H21N3O6/c17-11(6-7-14(21)22)15(23)18-9-13(20)19-12(16(24)25)8-10-4-2-1-3-5-10/h1-5,11-12H,6-9,17H2,(H,18,23)(H,19,20)(H,21,22)(H,24,25)