42189-56-0 Usage
Description
N-(1-PYRENYL)MALEIMIDE is a yellow solid that serves as a versatile reactant in the synthesis of various compounds and materials. It is particularly known for its application as a fluorescent sulfhydryl reagent, which can form excited-state dimers that emit at longer wavelengths than the lone excited fluorophore.
Uses
1. Used in Synthesis of Oligodeoxynucleotide Derivatives:
N-(1-PYRENYL)MALEIMIDE is used as a reactant in the synthesis of oligodeoxynucleotide derivatives, which are essential for various molecular biology applications, including gene expression analysis and DNA sequencing.
2. Used in Polymer Conjugates of Immunogenic Peptides:
In the field of immunology, N-(1-PYRENYL)MALEIMIDE is used as a reactant for the synthesis of polymer conjugates of immunogenic peptides. These conjugates play a crucial role in enhancing the immune response against specific antigens and are used in the development of vaccines and immunotherapies.
3. Used in Modified Oligonucleotides for Biosensing Applications:
N-(1-PYRENYL)MALEIMIDE is utilized as a reactant in the synthesis of modified oligonucleotides for biosensing applications. These modified oligonucleotides are employed in the development of sensitive and specific detection methods for various biological targets, such as nucleic acids, proteins, and small molecules.
4. Used in Synthesis of Thermally Stable Fluorescent Maleimide/Isobutene Alternating Copolymers:
N-(1-PYRENYL)MALEIMIDE is involved in the synthesis of thermally stable fluorescent maleimide/isobutene alternating copolymers. These copolymers have potential applications in various fields, including materials science, optics, and electronics, due to their unique optical and thermal properties.
5. Used as a Derivatizing Agent for Determination of Glutathione Disulfide Levels in Biological Samples:
N-(1-PYRENYL)MALEIMIDE is used as a derivatizing agent for the determination of glutathione disulfide (GSSG) levels in biological samples. GSSG is an important biomarker for oxidative stress and redox homeostasis, and its accurate measurement is essential for understanding various physiological and pathological processes.
6. Used as a Fluorescent Sulfur Reagent:
N-(1-PYRENYL)MALEIMIDE is a fluorescent sulfhydryl reagent that can form excited-state dimers, which emit at longer wavelengths than the lone excited fluorophore. This property makes it a valuable tool in various research applications, including protein labeling, fluorescence resonance energy transfer (FRET) studies, and the detection of thiols in biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 42189-56-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,1,8 and 9 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 42189-56:
(7*4)+(6*2)+(5*1)+(4*8)+(3*9)+(2*5)+(1*6)=120
120 % 10 = 0
So 42189-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H11NO2/c22-17-10-11-18(23)21(17)16-9-7-14-5-4-12-2-1-3-13-6-8-15(16)20(14)19(12)13/h1-11H
42189-56-0Relevant articles and documents
Efficient synthesis of fluorophore-linked maleimide derivatives
Reddy, Paidi Yella,Kondo, Satoru,Fujita, Satoshi,Toru, Takeshi
, p. 999 - 1002 (2007/10/03)
Lewis acid and hexamethyldisilazane promoted efficient synthesis of various fluorophore-linked maleimide derivatives from maleic anhydride and amines is described.