42504-87-0 Usage
Description
Azaniumyl-(2-methylpropyl)azanium is a diamine organic compound with the molecular formula (C4H12N2)2+. It is characterized by the presence of two 2-methylpropylazanium cations, each carrying a positive charge, resulting in an overall double positive charge for the compound. This salt is often utilized in coordination chemistry and organic synthesis, and its chemical properties render it suitable for a variety of applications in industry and research. Furthermore, it can act as a building block in the creation of more complex organic molecules.
Uses
Used in Coordination Chemistry:
Azaniumyl-(2-methylpropyl)azanium is used as a ligand in coordination chemistry for forming coordination complexes with metal ions. Its ability to bind with metals enhances the stability and reactivity of these complexes, which is crucial for various chemical reactions and applications.
Used in Organic Synthesis:
In the field of organic synthesis, azaniumyl-(2-methylpropyl)azanium is used as a reagent or intermediate for the synthesis of more complex organic molecules. Its presence of amino groups allows for a range of reactions, such as condensation, substitution, and addition, facilitating the creation of diverse organic compounds.
Used in Industry and Research:
Azaniumyl-(2-methylpropyl)azanium is utilized in various industrial processes and research applications due to its unique chemical properties. Its role as a building block for complex molecules and its ability to form stable complexes with metals make it valuable in the development of new materials and chemical products.
Used in Pharmaceutical Development:
In the pharmaceutical industry, azaniumyl-(2-methylpropyl)azanium can be used as a starting material for the synthesis of drug candidates. Its chemical versatility allows for the design and development of new therapeutic agents with potential applications in treating various diseases and medical conditions.
Used in Material Science:
In material science, azaniumyl-(2-methylpropyl)azanium may be employed in the synthesis of novel materials with specific properties. Its ability to form coordination complexes can contribute to the development of materials with tailored characteristics, such as conductivity, magnetism, or catalytic activity, for use in various technological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 42504-87-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,5,0 and 4 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 42504-87:
(7*4)+(6*2)+(5*5)+(4*0)+(3*4)+(2*8)+(1*7)=100
100 % 10 = 0
So 42504-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H14N2/c1-4(2)3-6-5/h4H,3,6H2,1-2,5H3/q+2
42504-87-0Relevant articles and documents
The synthesis of azapeptidomimetic beta-lactam molecules as potential protease inhibitors.
Malachowski, William P,Tie, Chenyang,Wang, Katherine,Broadrup, Robert L
, p. 8962 - 8969 (2007/10/03)
Synthetic methods for the construction of a novel peptidomimetic structure are reported. The structure incorporates a beta-lactam and an azapeptide in a peptide backbone with the intention of generating rationally designed substrate-based protease inhibitors. The beta-lactam is formed by subjecting serine or threonine-azapeptides to Mitsunobu reaction conditions. Importantly, the azapeptidomimetic beta-lactam structure permits extended binding inhibition and the synthetic methods to create tetrapeptidomimetic structures are described.
