42604-63-7 Usage
Structure
Cyclic urea derivative with a six-membered ring
Functional groups
a. Two methyl groups (-CH3) at positions 1 and 3
b. Three oxygen atoms (O) at positions 2, 4, and 6
c. A carbonyl group (C=O) at position 5
Applications
a. Building block in organic synthesis
b. Preparation of various pharmaceuticals and organic compounds
Biological activity
a. Potential inhibitor of certain enzymes
b. Studied for its potential applications in medicinal chemistry and drug development
Chemical properties
a. Reactivity with other compounds for organic synthesis
b. Stability under various conditions (e.g., temperature, pH)
Physical properties
a. Appearance (e.g., color, state of matter)
b. Solubility in different solvents (e.g., water, organic solvents)
c. Melting and boiling points (if available)
Safety and handling
a. Potential hazards (e.g., toxicity, flammability)
b. Recommended safety measures (e.g., personal protective equipment, storage conditions)
Check Digit Verification of cas no
The CAS Registry Mumber 42604-63-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,6,0 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 42604-63:
(7*4)+(6*2)+(5*6)+(4*0)+(3*4)+(2*6)+(1*3)=97
97 % 10 = 7
So 42604-63-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O4/c1-8-5(11)4(3-10)6(12)9(2)7(8)13/h3-4H,1-2H3
42604-63-7Relevant articles and documents
COMPOSITIONS, METHODS OF USE, AND METHODS OF TREATMENT
-
Page/Page column 38, (2015/04/15)
Embodiments of the present disclosure provide for compositions including an antimicrobial agent, pharmaceutical compositions including the antimicrobial agent, methods of treatment of an infection, methods of treatment using compositions or pharmaceutical