42732-49-0 Usage
Description
3-HYDROXY-5-METHYLPYRIDINE is an organic compound characterized by its light yellow crystalline structure. It is a heterocyclic compound with a pyridine ring, featuring a hydroxyl group at the 3rd position and a methyl group at the 5th position.
Uses
Used in Chemical Synthesis:
3-HYDROXY-5-METHYLPYRIDINE is used as a chemical intermediate for the preparation of various derivatives, specifically 3-hydroxy-5-methyl-2-nitropyridine, through a nitration reaction. This synthesis is crucial for the development of compounds with potential applications in different industries, such as pharmaceuticals or materials science.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-HYDROXY-5-METHYLPYRIDINE serves as a key building block for the synthesis of drugs with potential therapeutic properties. Its unique structure allows for the creation of novel compounds that can target specific biological pathways or receptors, contributing to the development of new medications.
Used in Materials Science:
3-HYDROXY-5-METHYLPYRIDINE can also be utilized in the field of materials science, where its chemical properties may be exploited to design and develop new materials with specific characteristics. These materials could have applications in various sectors, such as electronics, coatings, or adhesives, depending on the desired properties achieved through the synthesis process.
Check Digit Verification of cas no
The CAS Registry Mumber 42732-49-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,7,3 and 2 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 42732-49:
(7*4)+(6*2)+(5*7)+(4*3)+(3*2)+(2*4)+(1*9)=110
110 % 10 = 0
So 42732-49-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO/c1-5-2-6(8)4-7-3-5/h2-4,8H,1H3
42732-49-0Relevant articles and documents
Rhodium-catalyzed synthesis of 1,2-dihydropyridine by a tandem reaction of 4-(1-acetoxyallyl)-1-sulfonyl-1,2,3-triazole
Dai, Haican,Yu, Sisi,Cheng, Wanli,Xu, Ze-Feng,Li, Chuan-Ying
, p. 6417 - 6420 (2017/07/10)
A tandem reaction of 4-(1-acetoxyallyl)-1-sulfonyl-1,2,3-triazole including formation of α-imino rhodium carbene, 1,2-migration of an acetoxy group and six electron electrocyclic ring closure was reported. The migration of the OAc group with excellent chemoselectivity was the crucial process, leading to the formation of 1,2-dihydropyridine specifically in up to 90% yield. Several transformations of the dihydropyridine product were also achieved illustrating the potential of the protocol in organic synthesis. Based on the observation of the intermediate, a plausible mechanism was proposed.
