42959-40-0 Usage
General Description
"2-Chloro-5-hydroxynicotinic acid" is a chemical compound with the molecular formula C6H4ClNO3. It is a chlorinated derivative of 5-hydroxynicotinic acid, and it contains a chlorine atom and a hydroxyl group attached to a pyridine ring. 2-Chloro-5-hydroxynicotinic acid is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its potential biological activities. Some studies have suggested that it may have antimicrobial and antiviral properties, and it also has potential applications in the field of organic synthesis. Overall, 2-Chloro-5-hydroxynicotinic acid is a versatile chemical with various potential uses in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 42959-40-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,9,5 and 9 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 42959-40:
(7*4)+(6*2)+(5*9)+(4*5)+(3*9)+(2*4)+(1*0)=140
140 % 10 = 0
So 42959-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClNO3/c7-5-4(6(10)11)1-3(9)2-8-5/h1-2,9H,(H,10,11)