4297-95-4 Usage
Description
Sodium phenylphosphinate, also known as sodium diphenyl phosphinate, is an organophosphorus compound with the chemical formula (C6H5O)2P(ONa). It is a clear, colorless liquid that exhibits unique chemical properties, making it a versatile compound for various applications.
Uses
Used in Rare Earth Elements Research:
Sodium phenylphosphinate is used as a research compound for exploring the luminescent properties of lanthanides complexes. Lanthanides, a group of rare earth elements, are known for their unique optical and magnetic properties. Sodium phenylphosphinate plays a crucial role in enhancing the luminescence of these complexes, which can be applied in various fields such as lighting, displays, and sensing technologies.
Used in Chemical Synthesis:
Due to its unique chemical properties, sodium phenylphosphinate is also used as an intermediate in the synthesis of various organic compounds. Its ability to form stable complexes with metal ions makes it a valuable reagent in the preparation of catalysts and other specialty chemicals.
Used in Pharmaceutical Industry:
Sodium phenylphosphinate is used as a pharmaceutical intermediate for the development of new drugs. Its ability to form stable complexes with metal ions can be exploited in the design of novel therapeutic agents, particularly in the treatment of metal-related diseases and conditions.
Used in Analytical Chemistry:
Sodium phenylphosphinate is used as an analytical reagent in various spectroscopic and chromatographic techniques. Its ability to form complexes with metal ions makes it a valuable tool for the detection and quantification of trace metal ions in environmental, industrial, and biological samples.
Flammability and Explosibility
Notclassified
Check Digit Verification of cas no
The CAS Registry Mumber 4297-95-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,2,9 and 7 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4297-95:
(6*4)+(5*2)+(4*9)+(3*7)+(2*9)+(1*5)=114
114 % 10 = 4
So 4297-95-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H7O2P.Na/c7-9(8)6-4-2-1-3-5-6;/h1-5,9H,(H,7,8);/q;+1/p-1
