431-05-0 Usage
Description
1,1-Difluoroacetone is an organic compound characterized by the presence of two fluorine atoms attached to a carbonyl group. It is known for its unique chemical properties and reactivity, making it a valuable intermediate in the synthesis of various organic compounds.
Used in Pharmaceutical Industry:
1,1-Difluoroacetone is used as a key intermediate in the preparation of substituted THF amides, which serve as modulators of sodium channels. These modulators play a crucial role in the development of drugs targeting neurological disorders and pain management, due to their ability to regulate the flow of sodium ions across cell membranes, thereby influencing nerve signal transmission.
Check Digit Verification of cas no
The CAS Registry Mumber 431-05-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,3 and 1 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 431-05:
(5*4)+(4*3)+(3*1)+(2*0)+(1*5)=40
40 % 10 = 0
So 431-05-0 is a valid CAS Registry Number.
InChI:InChI=1/C3H4F2O/c1-2(6)3(4)5/h3H,1H3
431-05-0Relevant articles and documents
Process for producing 1,1,1-trifluoroacetone
-
Example 4,6, (2008/06/13)
A process for producing 1,1,1-trifluoroacetone includes the step of conducting a hydrogenolysis of a halogenated trifluoroacetone, which is represented by the general formula (1), by a hydrogen gas in the presence of a catalyst containing a transition metal, where X represents a chlorine, bromine or iodine, and n represents an integer from 1 to 3. It is possible to obtain 1,1,1-trifluoroacetone with a high yield by using the special catalyst.