4334-87-6 Usage
Description
3-Ethoxycarbonylphenylboronic acid is an organic compound that serves as a versatile reagent in various chemical reactions and synthesis processes. It is a white to light yellow crystalline powder, known for its unique chemical properties that make it suitable for a range of applications.
Uses
Used in Chemical Synthesis:
3-Ethoxycarbonylphenylboronic acid is used as a reactant for the Palladium-catalyzed Suzuki-Miyaura coupling, a widely employed method for the formation of carbon-carbon bonds, particularly in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Ethoxycarbonylphenylboronic acid is used as a reactant for the Palladium-catalyzed arylation of aldehydes, which is a crucial step in the synthesis of various pharmaceutical compounds.
Used in Organic Chemistry:
3-Ethoxycarbonylphenylboronic acid is used as a reactant in reductive cross-coupling reactions, which are essential for the formation of carbon-carbon and carbon-heteroatom bonds in organic chemistry.
Used in the Preparation of β3-Adrenergic Receptor Agonist:
3-Ethoxycarbonylphenylboronic acid is used as a key intermediate in the preparation of β3-adrenergic receptor agonists, which are important compounds in the treatment of various medical conditions, such as obesity and type 2 diabetes.
Used in Material Science:
In material science, 3-Ethoxycarbonylphenylboronic acid is used as a reactant in transmetalation reactions, which are vital for the synthesis of new materials with unique properties and potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 4334-87-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,3 and 4 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4334-87:
(6*4)+(5*3)+(4*3)+(3*4)+(2*8)+(1*7)=86
86 % 10 = 6
So 4334-87-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BO4/c1-2-14-9(11)7-4-3-5-8(6-7)10(12)13/h3-6,12-13H,2H2,1H3
