4357-95-3 Usage
Description
H-TYR-BETANA, also known as N-(2-naphthyl)-L-tyrosinamide, is an L-tyrosine derivative formed by the formal condensation of the carboxy group of L-tyrosine with the amino group of 2-naphthylamine. It is a compound with potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
H-TYR-BETANA is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure allows it to interact with specific biological targets, making it a candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, H-TYR-BETANA serves as a valuable compound for studying the interactions between L-tyrosine and other molecules. This can lead to a better understanding of various biological processes and the development of novel therapeutic strategies.
Used in Material Science:
H-TYR-BETANA's unique chemical properties may also find applications in material science, where it could be used to develop new materials with specific properties, such as improved stability or enhanced interaction with other molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 4357-95-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,5 and 7 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4357-95:
(6*4)+(5*3)+(4*5)+(3*7)+(2*9)+(1*5)=103
103 % 10 = 3
So 4357-95-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H18N2O2/c20-18(11-13-5-9-17(22)10-6-13)19(23)21-16-8-7-14-3-1-2-4-15(14)12-16/h1-10,12,18,22H,11,20H2,(H,21,23)/t18-/m0/s1