436086-98-5 Usage
Description
Furan-2-ylmethyl-pyridin-4-ylmethyl-amine, a heterocyclic amine with the molecular formula C13H13N3O, is a chemical compound that features both furan and pyridine rings in its structure. This unique arrangement of heteroatoms and aromatic rings endows it with potential applications in various fields, contingent upon further research and testing to explore its specific properties.
Uses
Used in Organic Synthesis:
Furan-2-ylmethyl-pyridin-4-ylmethyl-amine is used as a synthetic intermediate for the creation of more complex organic molecules. Its presence of both furan and pyridine rings makes it a versatile building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, Furan-2-ylmethyl-pyridin-4-ylmethyl-amine is utilized as a potential candidate for drug discovery. Its heterocyclic nature allows for the development of new pharmaceutical agents that could target specific biological pathways or receptors, pending further investigation into its bioactivity and pharmacological properties.
Used in Chemical Research:
Furan-2-ylmethyl-pyridin-4-ylmethyl-amine serves as a subject of study in chemical research, where its reactivity, stability, and interaction with other molecules are explored. Understanding these characteristics can lead to the discovery of new reactions or mechanisms that are valuable in the synthesis of novel compounds.
Used in Material Science:
Although not explicitly mentioned in the provided materials, the compound's structure suggests potential applications in material science, where its electronic properties and molecular arrangement could be harnessed for the development of new materials with specific functionalities, such as in sensors or electronic devices.
Check Digit Verification of cas no
The CAS Registry Mumber 436086-98-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 436086-98:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*6)+(2*9)+(1*8)=165
165 % 10 = 5
So 436086-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O/c1-2-11(14-7-1)9-13-8-10-3-5-12-6-4-10/h1-7,13H,8-9H2
