4420-88-6 Usage
Description
Lysine-2-naphthylamide is an L-lysine derivative that is formed by the formal condensation of the carboxy group of L-lysine with the amino group of 2-naphthylamine. It is a compound with potential applications in various fields.
Uses
Used in Research Applications:
Lysine-2-naphthylamide is used as a research tool for studying the properties and functions of L-lysine and its derivatives. It can be employed in biochemical and biophysical experiments to investigate the interactions of L-lysine with other molecules and its role in various biological processes.
Used in Pharmaceutical Industry:
Lysine-2-naphthylamide can be used as a building block or intermediate in the synthesis of pharmaceutical compounds. Its unique structure and properties may contribute to the development of new drugs with specific therapeutic effects.
Used in Analytical Chemistry:
Lysine-2-naphthylamide can be used as a chromogenic or fluorogenic reagent in analytical chemistry for the detection and quantification of L-lysine or related compounds. Its distinct spectral properties can be exploited for sensitive and selective assays.
Used in Material Science:
Lysine-2-naphthylamide may have potential applications in material science, such as the development of novel materials with specific properties or functions. Its chemical structure and reactivity can be utilized to create new materials with potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 4420-88-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,2 and 0 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4420-88:
(6*4)+(5*4)+(4*2)+(3*0)+(2*8)+(1*8)=76
76 % 10 = 6
So 4420-88-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H21N3O/c17-10-4-3-7-15(18)16(20)19-14-9-8-12-5-1-2-6-13(12)11-14/h1-2,5-6,8-9,11,15H,3-4,7,10,17-18H2,(H,19,20)/t15-/m0/s1
