4426-76-0 Usage
Description
2-ISOTHIOCHROMAN-4-ONE, also known as Isothiochromanone, is a cyclic sulfide compound that serves as a crucial reagent in the synthesis of various heterocyclic ring-constrained norepinephrine reuptake inhibitors. Its unique chemical structure and properties make it a valuable component in the development of pharmaceuticals and other chemical applications.
Uses
Used in Pharmaceutical Industry:
2-ISOTHIOCHROMAN-4-ONE is used as a reagent for the synthesis of heterocyclic ring-constrained norepinephrine reuptake inhibitors. These inhibitors play a significant role in the treatment of various neurological and psychiatric disorders, such as depression, anxiety, and attention deficit hyperactivity disorder (ADHD). 2-ISOTHIOCHROMAN-4-ONE's ability to form constrained structures enhances the selectivity and potency of the resulting inhibitors, making it an essential component in the development of more effective medications.
Additionally, 2-ISOTHIOCHROMAN-4-ONE may also be utilized in other chemical industries for various applications, such as the synthesis of other heterocyclic compounds, organic synthesis, and as an intermediate in the production of specialty chemicals. Its versatility and unique properties make it a valuable asset in the field of chemistry and related industries.
Check Digit Verification of cas no
The CAS Registry Mumber 4426-76-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,2 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4426-76:
(6*4)+(5*4)+(4*2)+(3*6)+(2*7)+(1*6)=90
90 % 10 = 0
So 4426-76-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8OS/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2
