442847-66-7 Usage
General Description
p-Nitrobenzyl (5R,6S)-2-(diphenylphosphoryloxy)-6-((1R)-1-hydroxyethyl)carbapen-2-em-3-carboxylate is a chemical compound with a complex structure, primarily used in the field of medicinal chemistry. Its structure includes a carbapenem ring, which is a class of antibiotics with a broad spectrum of activity against many bacteria. The compound also contains a nitrobenzyl group, which is often used as a protecting group in organic synthesis to prevent undesired reactions. The presence of a phosphoryloxy group and a hydroxyethyl group suggest potential reactivity with phosphorylating agents and enzymes involved in phosphorylation processes. Overall, the compound's structure and functional groups make it a potentially valuable molecule for the development of new antibiotics or pharmaceuticals with specific biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 442847-66-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,2,8,4 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 442847-66:
(8*4)+(7*4)+(6*2)+(5*8)+(4*4)+(3*7)+(2*6)+(1*6)=167
167 % 10 = 7
So 442847-66-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H21N3O6S.ClH/c1-10(22)15-13-8-14(28-7-6-19)16(20(13)17(15)23)18(24)27-9-11-2-4-12(5-3-11)21(25)26;/h2-5,10,13,15,22H,6-9,19H2,1H3;1H/t10-,13-,15-;/m1./s1