444080-03-9 Usage
Description
Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is a chemical compound that features a benzoic acid core with an attached 3-[(3,5-dimethoxybenzoyl)amino] group. Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is known for its versatile properties and is utilized in the production of various pharmaceuticals, particularly as an intermediate in the synthesis of other organic compounds. Its potential applications extend across the fields of medicine, biochemistry, and organic chemistry, making it a valuable asset for research and development in creating new compounds with specific properties and functions.
Uses
Used in Pharmaceutical Production:
Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new medicinal compounds.
Used in Research and Development:
In the field of research and development, Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is used as a building block for creating new compounds with specific properties and functions, contributing to scientific advancements and innovation in various industries.
Used in Medicine:
Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is utilized in medicine for its potential applications in the treatment and management of various health conditions, thanks to its unique chemical structure and properties.
Used in Biochemistry:
In biochemistry, this compound is employed for its role in understanding and manipulating biological processes, potentially leading to breakthroughs in the study of enzymes, metabolic pathways, and other biochemical phenomena.
Used in Organic Chemistry:
Benzoic acid, 3-[(3,5-dimethoxybenzoyl)amino]is also used in organic chemistry as a key component in the synthesis of complex organic molecules, facilitating the development of novel organic materials and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 444080-03-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,4,0,8 and 0 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 444080-03:
(8*4)+(7*4)+(6*4)+(5*0)+(4*8)+(3*0)+(2*0)+(1*3)=119
119 % 10 = 9
So 444080-03-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H15NO5/c1-21-13-7-11(8-14(9-13)22-2)15(18)17-12-5-3-4-10(6-12)16(19)20/h3-9H,1-2H3,(H,17,18)(H,19,20)