4448-95-7 Usage
General Description
The chemical "(3R,8aα)-2,3,4,7,8,8a-Hexahydro-4β-hydroxy-8β-(hydroxymethyl)-8α-methyl-1H-3aα,7α-methanoazulene-3β,6-dicarboxylic acid" is a complex organic compound with a long and specific molecular structure. It contains a range of functional groups including hydroxyl, carboxylic acid, and methyl groups. The compound is classified as a dicarboxylic acid, indicating that it contains two carboxylic acid functional groups. The structure of the compound suggests that it may have potential pharmaceutical or biological activity, possibly due to the presence of the hydroxyl and carboxylic acid groups which are commonly found in bioactive compounds. Further research and analysis would be required to determine the specific properties and potential applications of this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 4448-95-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,4 and 8 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4448-95:
(6*4)+(5*4)+(4*4)+(3*8)+(2*9)+(1*5)=107
107 % 10 = 7
So 4448-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H20O6/c1-14(6-16)9-5-15(11(17)4-7(9)12(18)19)8(13(20)21)2-3-10(14)15/h4,8-11,16-17H,2-3,5-6H2,1H3,(H,18,19)(H,20,21)/t8-,9-,10-,11-,14+,15+/m0/s1