446044-44-6 Usage
General Description
The chemical (1R,2R)-2-(anthracene-2,3-dicarboximido)cyclohexanecarboxylic acid is a compound consisting of a cyclohexane ring and an anthracene moiety connected through a dicarboximide linker. It is used as a building block for the synthesis of various organic compounds, especially in the field of medicinal chemistry and material science. The anthracene group provides the compound with aromatic and fluorescent properties, while the cyclohexane carboxylic acid functionality allows for further derivatization and modification. (1R,2R)-2-(ANTHRACENE-2,3-DICARBOXIMIDO)CYCLOHEXANECARBOXYLIC ACID has potential applications in the development of organic electronic materials, fluorescent probes, and as a scaffold for drug design. Additionally, its unique structure and properties make it a valuable tool for studying molecular interactions and chemical reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 446044-44-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,6,0,4 and 4 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 446044-44:
(8*4)+(7*4)+(6*6)+(5*0)+(4*4)+(3*4)+(2*4)+(1*4)=136
136 % 10 = 6
So 446044-44-6 is a valid CAS Registry Number.
InChI:InChI=1/C23H19NO4/c25-21-18-11-15-9-13-5-1-2-6-14(13)10-16(15)12-19(18)22(26)24(21)20-8-4-3-7-17(20)23(27)28/h1-2,5-6,9-12,17,20H,3-4,7-8H2,(H,27,28)/t17-,20-/m1/s1