4479-38-3 Usage
Chemical structure
A complex structure containing cyclohexyl, chloro, hydroxy, phenyl, amino, and naphthalen-2-ol moieties.
Classification
Belongs to the class of naphthalene derivatives.
Applications
Commonly used in the pharmaceutical and chemical industries for various purposes.
Medicinal chemistry
Has potential applications in the development of new drugs targeting specific biological pathways or receptors.
Unique structure
Its unique structure and properties make it a valuable building block for the synthesis of novel compounds with potential therapeutic effects.
Versatility
Diverse functional groups make it a versatile starting material for the synthesis of other complex organic molecules.
Other potential applications
May have potential applications in the areas of agrochemicals and materials science, offering promising opportunities for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 4479-38-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,7 and 9 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4479-38:
(6*4)+(5*4)+(4*7)+(3*9)+(2*3)+(1*8)=113
113 % 10 = 3
So 4479-38-3 is a valid CAS Registry Number.
InChI:InChI=1/C24H25Cl2NO2/c25-18-12-17(24(29)22(26)13-18)14-27(19-7-2-1-3-8-19)15-21-20-9-5-4-6-16(20)10-11-23(21)28/h4-6,9-13,19,28-29H,1-3,7-8,14-15H2