4485-16-9 Usage
Description
4-METHYL HEPTENE-3, with the molecular formula C8H16, is a colorless liquid belonging to the alkene family. It possesses a strong, unpleasant odor and features a double bond between the third and fourth carbon atoms. This chemical compound is known for its versatile applications across various industries.
Uses
Used in Plastics and Resins Industry:
4-METHYL HEPTENE-3 is used as a monomer in the production of plastics, resins, and synthetic rubbers. Its unique properties contribute to the development of materials with specific characteristics, enhancing their performance and utility in various applications.
Used as a Solvent:
In the chemical industry, 4-METHYL HEPTENE-3 serves as a solvent for various substances. Its ability to dissolve a wide range of compounds makes it a valuable component in numerous chemical processes and formulations.
Used as a Fuel Additive:
4-METHYL HEPTENE-3 is utilized as a fuel additive to improve the performance and efficiency of fuels. Its incorporation can lead to better combustion, reduced emissions, and enhanced energy output.
Used in Fragrance Manufacturing:
In the fragrance industry, 4-METHYL HEPTENE-3 is used in the manufacturing of various scented products. Its distinctive odor makes it a valuable component in creating unique and appealing fragrances.
Used as a Flavoring Agent in the Food Industry:
4-METHYL HEPTENE-3 also finds application as a flavoring agent in the food industry. Its ability to impart specific tastes and aromas contributes to the development of a wide range of food products.
Check Digit Verification of cas no
The CAS Registry Mumber 4485-16-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,8 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4485-16:
(6*4)+(5*4)+(4*8)+(3*5)+(2*1)+(1*6)=99
99 % 10 = 9
So 4485-16-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H16/c1-4-6-8(3)7-5-2/h6H,4-5,7H2,1-3H3/b8-6+
