4510-76-3 Usage
General Description
2,4-Dihydroxyquinoline monosodium salt is a chemical compound with potential applications in various fields due to its properties. As a derivative of quinoline, it carries specific bioactive properties that could be harnessed for pharmaceutical purposes. It has a single sodium (Na) ion, which makes it a monosodium salt. By structure, it features two hydroxy (-OH) functional groups attached to a quinoline molecule at the 2nd and 4th positions. While its specific use is dependent on the context, safety measures should be adhered to as the chemical may pose risks under certain conditions. Its potential applications and properties, however, warrant further study.
Check Digit Verification of cas no
The CAS Registry Mumber 4510-76-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,5,1 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4510-76:
(6*4)+(5*5)+(4*1)+(3*0)+(2*7)+(1*6)=73
73 % 10 = 3
So 4510-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO2.Na/c11-8-5-9(12)10-7-4-2-1-3-6(7)8;/h1-5H,(H2,10,11,12);/q;+1/p-1
