4711-67-5 Usage
General Description
N-(2-Ethoxyphenyl)naphthalene-2-carboxamide is a chemical compound with the molecular formula C23H21NO2. It is a substituted carboxamide, which means it contains a carboxyl group (COOH) attached to an amine group (NH2) and a substituted naphthalene ring. The presence of the ethoxyphenyl group indicates that there is an ethyl group attached to the phenyl ring. N-(2-Ethoxyphenyl)naphthalene-2-carboxamide has potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. Its specific properties and potential uses would depend on its precise structure and features.
Check Digit Verification of cas no
The CAS Registry Mumber 4711-67-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,1 and 1 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4711-67:
(6*4)+(5*7)+(4*1)+(3*1)+(2*6)+(1*7)=85
85 % 10 = 5
So 4711-67-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H17NO2/c1-2-22-18-10-6-5-9-17(18)20-19(21)16-12-11-14-7-3-4-8-15(14)13-16/h3-13H,2H2,1H3,(H,20,21)