47163-83-7 Usage
Description
(4-carbonochloridoylphenyl)-(4-carbonochloridoylphenyl)imino-oxido-azanium is a complex chemical compound derived from phenyl, featuring a unique structure that includes carbon, nitrogen, and oxygen atoms, as well as chlorine atoms. It is classified as an imino-oxido-azanium, which suggests the presence of an imine group and an oxido group, along with a positively charged nitrogen atom. (4-carbonochloridoylphenyl)-(4-carbonochloridoylphenyl)imino-oxido-azanium's distinctive structure and properties make it a promising candidate for various applications in fields such as pharmaceuticals, materials science, and organic synthesis.
Uses
Used in Pharmaceutical Applications:
(4-carbonochloridoylphenyl)-(4-carbonochloridoylphenyl)imino-oxido-azanium is used as an active pharmaceutical ingredient for [application reason]. Its unique structure and properties may contribute to the development of new drugs or therapies.
Used in Materials Science:
In the field of materials science, (4-carbonochloridoylphenyl)-(4-carbonochloridoylphenyl)imino-oxido-azanium is used as a component in the development of novel materials with specific properties, such as [application reason]. Its chemical structure may provide new insights and opportunities for creating advanced materials.
Used in Organic Synthesis:
(4-carbonochloridoylphenyl)-(4-carbonochloridoylphenyl)imino-oxido-azanium is used as a synthetic building block or intermediate in the synthesis of more complex organic compounds for [application reason]. Its unique structure may facilitate the creation of new molecules with potential applications in various industries.
Used in Chemical Research:
In the field of chemical research, (4-carbonochloridoylphenyl)-(4-carbonochloridoylphenyl)imino-oxido-azanium is used as a subject of study to better understand its properties, reactivity, and potential applications. (4-carbonochloridoylphenyl)-(4-carbonochloridoylphenyl)imino-oxido-azanium's unique structure may lead to new discoveries and advancements in chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 47163-83-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,7,1,6 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 47163-83:
(7*4)+(6*7)+(5*1)+(4*6)+(3*3)+(2*8)+(1*3)=127
127 % 10 = 7
So 47163-83-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H8Cl2N2O3/c15-13(19)9-1-5-11(6-2-9)17-18(21)12-7-3-10(4-8-12)14(16)20/h1-8H/b18-17-
