474711-89-2 Usage
Description
PIPERAZINE-1-CARBOXYLIC ACID AMIDE HCL, also known as Piperazine-1-carboxamide hydrochloride, is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and chemical compounds. It is characterized by its heterocyclic structure, which includes a piperazine ring and a carboxamide functional group. This unique structure endows it with versatile chemical properties, making it a valuable building block in the development of new drugs and other applications.
Uses
Used in Pharmaceutical Industry:
PIPERAZINE-1-CARBOXYLIC ACID AMIDE HCL is used as a key intermediate in the synthesis of heteroaromatic derivatives, specifically as phosphodiesterase 4 (PDE4) inhibitors. PDE4 inhibitors are a class of drugs that modulate the activity of the PDE4 enzyme, which plays a crucial role in various physiological processes, including inflammation and immune response. By inhibiting PDE4, these compounds can help regulate these processes and have potential therapeutic applications in treating conditions such as asthma, chronic obstructive pulmonary disease (COPD), and inflammatory disorders.
In the synthesis of PDE4 inhibitors, PIPERAZINE-1-CARBOXYLIC ACID AMIDE HCL serves as a crucial component, providing the necessary structural features for the development of these drugs. Its presence in the molecular structure allows for the formation of active compounds that can effectively bind to and inhibit the PDE4 enzyme, leading to the desired therapeutic effects.
Overall, PIPERAZINE-1-CARBOXYLIC ACID AMIDE HCL is a valuable compound in the pharmaceutical industry, playing a significant role in the development of PDE4 inhibitors and other related drugs. Its unique structure and properties make it an essential building block in the synthesis of these therapeutic agents, contributing to the advancement of treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 474711-89-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,4,7,1 and 1 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 474711-89:
(8*4)+(7*7)+(6*4)+(5*7)+(4*1)+(3*1)+(2*8)+(1*9)=172
172 % 10 = 2
So 474711-89-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H11N3O/c6-5(9)8-3-1-7-2-4-8/h7H,1-4H2,(H2,6,9)
474711-89-2Relevant articles and documents
HETEROAROMATIC DERIVATIVES AND PHARMACEUTICAL APPLICATIONS THEREOF
-
Paragraph 00403, (2016/05/02)
Disclosed are heteroaryl derivatives, pharmaceutical composition and uses in the manufacture of a medicine for treating respiratory diseases, especially for chronic obstructive pulmonary disease (COPD).
3- Or 4-monosubstituted phenol derivatives useful as H3 ligands
-
Page/Page column 59, (2010/02/14)
The invention relates to 3- or 4-monosubstituted phenol derivatives and to processes for the preparation of, intermediates used in the preparation of, compositions containing and the uses of, such derivatives. Said 3- or 4-monosubstituted phenol derivatives are H3 ligands and are useful in numerous diseases, disorders and conditions, in particular inflammatory, allergic and respiratory diseases, disorders and conditions.