4763-79-5 Usage
Molecular weight
416.5 g/mol
Physical state
Crystalline solid
Main properties
Fluorescent probe: BZ-VBA shows potential as a fluorescent probe for detecting metal ions.
Photosensitizer: It can act as a photosensitizer for photodynamic therapy.
Unique structure
Contains a benzoxazole ring and a vinyl phenyl group.
Applications
Organic synthesis: Used in organic synthesis processes.
Medicinal chemistry research: Valued in medicinal chemistry research due to its potential applications as a fluorescent probe and photosensitizer.
Potential applications
Metal ion detection: Utilized for detecting metal ions due to its fluorescent properties.
Photodynamic therapy: Used in photodynamic therapy for its photosensitizing capabilities.
Check Digit Verification of cas no
The CAS Registry Mumber 4763-79-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,6 and 3 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4763-79:
(6*4)+(5*7)+(4*6)+(3*3)+(2*7)+(1*9)=115
115 % 10 = 5
So 4763-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C22H15NO3/c24-22(25)18-13-9-16(10-14-18)6-5-15-7-11-17(12-8-15)21-23-19-3-1-2-4-20(19)26-21/h1-14H,(H,24,25)/b6-5+