4774-35-0 Usage
Description
4-Hydroxy-pyrimidine-5-carboxylic acid methyl ester is an organic compound that serves as a crucial building block in the synthesis of various chemical products. It is characterized by its pale yellow solid appearance and plays a significant role in the development of new compounds with diverse applications.
Uses
Used in Chemical Synthesis:
4-Hydroxy-pyrimidine-5-carboxylic acid methyl ester is used as a building block in chemical synthesis for the development of new products. Its unique structure allows it to be a valuable component in the creation of various compounds with different properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Hydroxy-pyrimidine-5-carboxylic acid methyl ester is used as a key intermediate in the synthesis of therapeutic agents. Its incorporation into drug molecules can potentially enhance their efficacy and selectivity, leading to the development of more effective treatments for various medical conditions.
Used in Research and Development:
4-Hydroxy-pyrimidine-5-carboxylic acid methyl ester is also utilized in research and development for the exploration of new chemical reactions and the synthesis of novel compounds. Its versatility as a building block makes it an essential tool for scientists and researchers working on the discovery and development of new materials and pharmaceuticals.
Used in Material Science:
In the field of material science, 4-Hydroxy-pyrimidine-5-carboxylic acid methyl ester can be employed as a component in the development of advanced materials with specific properties. Its integration into the molecular structure of these materials can lead to improved performance and functionality, making it a valuable asset in the creation of innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 4774-35-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,7 and 4 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4774-35:
(6*4)+(5*7)+(4*7)+(3*4)+(2*3)+(1*5)=110
110 % 10 = 0
So 4774-35-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3/c1-11-6(10)4-2-7-3-8-5(4)9/h2-3H,1H3,(H,7,8,9)
4774-35-0Relevant articles and documents
Amide compounds and uses thereof
-
Page/Page column 61, (2021/10/11)
Provided herein are novel amide compounds of formula (I), pharmaceutical compositions comprising same, methods for preparing same, and uses thereof, wherein the definition of each symbol is as described in the description.
