482-95-1 Usage
Description
(3β,20α)-16,17-Didehydro-11-methoxy-19α-methyl-18-oxayohimban-16-carboxylic acid methyl ester is a complex organic molecule derived from the alkaloid yohimbine, featuring a methoxy group at the 11th position, a methyl group at the 19th position, and an oxayohimban ring system. The presence of these functional groups endows the compound with potential pharmacological properties, allowing it to interact with various biological targets within the body. As a derivative of the parent compound, it is likely synthesized for research or pharmaceutical applications, with its specific properties and uses requiring further investigation through in-depth studies and experimentation.
Uses
Used in Pharmaceutical Research:
(3β,20α)-16,17-Didehydro-11-methoxy-19α-methyl-18-oxayohimban-16-carboxylic acid methyl ester is used as a research compound for exploring its potential pharmacological properties and interactions with biological targets. (3β,20α)-16,17-Didehydro-11-methoxy-19α-methyl-18-oxayohimban-16-carboxylic acid methyl ester's structural similarity to yohimbine and the presence of functional groups make it a promising candidate for investigating various therapeutic applications.
Used in Drug Development:
In the pharmaceutical industry, (3β,20α)-16,17-Didehydro-11-methoxy-19α-methyl-18-oxayohimban-16-carboxylic acid methyl ester is used as a lead compound in the development of new drugs. Its unique structure and functional groups may provide insights into the design of novel therapeutic agents targeting specific biological pathways or receptors.
Used in Chemical Synthesis:
(3β,20α)-16,17-Didehydro-11-methoxy-19α-methyl-18-oxayohimban-16-carboxylic acid methyl ester serves as a starting material or intermediate in the synthesis of other complex organic molecules. Its unique structure and functional groups can be further modified or utilized to create a variety of compounds with different properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 482-95-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 2 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 482-95:
(5*4)+(4*8)+(3*2)+(2*9)+(1*5)=81
81 % 10 = 1
So 482-95-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N2O4/c1-12-17-10-24-7-6-15-14-5-4-13(26-2)8-19(14)23-21(15)20(24)9-16(17)18(11-28-12)22(25)27-3/h4-5,8,11-12,16-17,20,23H,6-7,9-10H2,1-3H3/t12-,16-,17-,20+/m0/s1