482-98-4 Usage
Chemical compound
16,18-reserpinediol is a chemical compound derived from the plant Rauvolfia serpentina, commonly known as Indian snakeroot.
Natural alkaloid
It is a natural alkaloid, which means it is a naturally occurring chemical compound that contains mostly basic nitrogen atoms.
Traditional medicine
16,18-reserpinediol has been used in traditional medicine for its antipsychotic and antihypertensive properties.
Antipsychotic properties
It has been used to treat psychiatric disorders such as schizophrenia and bipolar disorder.
Antihypertensive properties
16,18-reserpinediol is known for its ability to lower blood pressure by blocking the release of certain neurotransmitters in the brain.
Anticancer properties
This compound has been studied for its potential anticancer properties.
Anti-inflammatory properties
It has also been studied for its potential anti-inflammatory properties.
Therapeutic applications
16,18-reserpinediol continues to be researched for its therapeutic applications due to its range of potential medicinal benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 482-98-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 2 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 482-98:
(5*4)+(4*8)+(3*2)+(2*9)+(1*8)=84
84 % 10 = 4
So 482-98-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H30N2O4/c1-27-13-3-4-14-15-5-6-24-10-12-7-20(26)22(28-2)17(11-25)16(12)9-19(24)21(15)23-18(14)8-13/h3-4,8,12,16-17,19-20,22-23,25-26H,5-7,9-11H2,1-2H3/t12-,16+,17+,19-,20-,22-/m1/s1