501921-30-8 Usage
General Description
(3aS,6aR)-Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one is a chemical compound with the molecular formula C7H10O3. It is a tetrahydrofuran derivative with a methoxy group attached to the furofuran ring. (3aS,6aR)-Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one is used in organic chemistry as a building block for the synthesis of other more complex molecules. It is also known for its potential biological activities and is being studied for its potential pharmacological applications. Additionally, it is used in the pharmaceutical industry as a key intermediate in the production of various drugs. Overall, "(3aS,6aR)-Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one" has important applications in organic synthesis and potential pharmaceutical uses.
Check Digit Verification of cas no
The CAS Registry Mumber 501921-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,1,9,2 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 501921-30:
(8*5)+(7*0)+(6*1)+(5*9)+(4*2)+(3*1)+(2*3)+(1*0)=108
108 % 10 = 8
So 501921-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O4/c1-9-7-4-2-6(8)11-5(4)3-10-7/h4-5,7H,2-3H2,1H3
