5034-75-3 Usage
General Description
1-AMINO-2-PHENYLCYCLOHEXANECARBOXYLIC ACID is a chemical compound with the molecular formula C12H15NO2. It is an amino acid derivative containing a cyclohexane ring with a carboxylic acid group and an amino group attached to it. 1-AMINO-2-PHENYLCYCLOHEXANECARBOXYLIC ACID is commonly used in organic synthesis and pharmaceutical research due to its potential pharmacological properties. Its structure suggests that it may have some biological activities, such as acting as an agonist at certain receptors or inhibiting certain enzymes. Further research and studies are necessary to fully understand the potential applications and effects of 1-AMINO-2-PHENYLCYCLOHEXANECARBOXYLIC ACID.
Check Digit Verification of cas no
The CAS Registry Mumber 5034-75-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,3 and 4 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5034-75:
(6*5)+(5*0)+(4*3)+(3*4)+(2*7)+(1*5)=73
73 % 10 = 3
So 5034-75-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H17NO2/c14-13(12(15)16)9-5-4-8-11(13)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9,14H2,(H,15,16)