50376-99-3 Usage
General Description
3,4-Bis(1-methylhydrazino)cyclobut-3-ene-1,2-dione is a synthetic chemical compound with the molecular formula C6H10N4O2. It is a cyclic hydrazone and is used in various chemical and pharmaceutical applications. This chemical is a potent inhibitor of NADPH oxidase and has shown potential in the treatment of inflammatory diseases and cancer. Additionally, it has been studied for its antiviral and antibacterial properties. Due to its unique structure and reactivity, 3,4-Bis(1-methylhydrazino)cyclobut-3-ene-1,2-dione has potential for further research and development in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 50376-99-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,3,7 and 6 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 50376-99:
(7*5)+(6*0)+(5*3)+(4*7)+(3*6)+(2*9)+(1*9)=123
123 % 10 = 3
So 50376-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N4O2/c1-9(7)3-4(10(2)8)6(12)5(3)11/h7-8H2,1-2H3