507472-18-6 Usage
General Description
FMOC-(S)-3-AMINO-3-(3-BROMO-PHENYL)-PROPIONIC ACID is a chemical compound with the molecular formula C22H20BrNO4. It is a derivative of the amino acid alanine and contains a fluorine-protected group (FMOC) and a bromine-substituted phenyl group. FMOC-(S)-3-AMINO-3-(3-BROMO-PHENYL)-PROPIONIC ACID is commonly used in organic synthesis and chemical research as a building block for the creation of larger, more complex molecules. It is often employed in the production of peptides and other bioactive compounds, and its unique structure makes it a valuable tool for studying protein structure and function. Additionally, its chiral nature allows it to be used in the development of pharmaceuticals and agrochemicals. Overall, FMOC-(S)-3-AMINO-3-(3-BROMO-PHENYL)-PROPIONIC ACID is a versatile and valuable compound in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 507472-18-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,7,4,7 and 2 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 507472-18:
(8*5)+(7*0)+(6*7)+(5*4)+(4*7)+(3*2)+(2*1)+(1*8)=146
146 % 10 = 6
So 507472-18-6 is a valid CAS Registry Number.
InChI:InChI=1/C24H20BrNO4/c25-16-7-5-6-15(12-16)22(13-23(27)28)26-24(29)30-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1