507472-28-8 Usage
General Description
FMOC-(R)-3-AMINO-3-(3-METHYL-PHENYL)-PROPIONIC ACID is a compound used in the field of organic chemistry and pharmaceutical research. It is a derivative of 3-amino-3-(3-methyl-phenyl)-propionic acid, with the addition of the FMOC (9-fluorenylmethoxycarbonyl) protecting group. FMOC-(R)-3-AMINO-3-(3-METHYL-PHENYL)-PROPIONIC ACID is commonly used as a building block in the synthesis of peptides and other biologically active molecules. The FMOC protecting group can be easily removed under mild conditions, making it a useful compound for the preparation of peptide libraries and drug development. Additionally, the presence of an amino group in the molecule makes it suitable for various chemical reactions and modifications.
Check Digit Verification of cas no
The CAS Registry Mumber 507472-28-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,7,4,7 and 2 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 507472-28:
(8*5)+(7*0)+(6*7)+(5*4)+(4*7)+(3*2)+(2*2)+(1*8)=148
148 % 10 = 8
So 507472-28-8 is a valid CAS Registry Number.
InChI:InChI=1/C25H23NO4/c1-16-7-6-8-17(13-16)23(14-24(27)28)26-25(29)30-15-22-20-11-4-2-9-18(20)19-10-3-5-12-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28)/t23-/m1/s1