50877-44-6 Usage
Description
4-Bromo-5-methyl-1-phenyl-1H-pyrazole is a pyrazole derivative with the molecular formula C10H9BrN2. It is a chemical compound that is widely used in organic synthesis and pharmaceutical research. 4-BROMO-5-METHYL-1-PHENYL-1H-PYRAZOLE is known for its potential biological activities, including anticancer, antiviral, and anti-inflammatory properties. Additionally, it serves as a building block in the synthesis of more complex organic molecules, making it a valuable component in the field of medicinal chemistry and drug discovery.
Uses
Used in Pharmaceutical Research:
4-Bromo-5-methyl-1-phenyl-1H-pyrazole is used as a key intermediate in the synthesis of pharmaceutical compounds for various therapeutic applications. Its unique structure and properties allow it to be a versatile building block in the development of new drugs.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-Bromo-5-methyl-1-phenyl-1H-pyrazole is utilized as a starting material for the design and synthesis of novel molecules with potential therapeutic effects. Its presence in these molecules can contribute to their biological activity and pharmacological properties.
Used in Anticancer Applications:
4-Bromo-5-methyl-1-phenyl-1H-pyrazole has been investigated for its anticancer properties, making it a candidate for use in cancer research and drug development. Its potential to target and inhibit the growth of cancer cells positions it as a valuable compound in the search for new cancer treatments.
Used in Antiviral Applications:
4-BROMO-5-METHYL-1-PHENYL-1H-PYRAZOLE has also demonstrated antiviral properties, which makes it a candidate for use in antiviral research and the development of treatments for viral infections. Its ability to interfere with viral replication and infectivity can contribute to the creation of new antiviral therapies.
Used in Anti-inflammatory Applications:
4-Bromo-5-methyl-1-phenyl-1H-pyrazole has shown anti-inflammatory effects, which can be beneficial in the treatment of various inflammatory conditions. Its potential to modulate inflammatory responses and alleviate symptoms makes it a promising compound for use in anti-inflammatory drug development.
Used in Organic Synthesis:
As a pyrazole derivative, 4-Bromo-5-methyl-1-phenyl-1H-pyrazole is used as a reagent and building block in organic synthesis. Its chemical properties allow it to participate in a variety of reactions, facilitating the creation of more complex organic molecules for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 50877-44-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,8,7 and 7 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 50877-44:
(7*5)+(6*0)+(5*8)+(4*7)+(3*7)+(2*4)+(1*4)=136
136 % 10 = 6
So 50877-44-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrN2/c1-8-10(11)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3
