50899-10-0 Usage
Description
2-METHOXYETHYL-4-AMINOCROTONATE is an organic compound that serves as a crucial intermediate in the synthesis of various pharmaceutical compounds. It is characterized by its molecular structure, which includes a methoxyethyl group and an aminocrotonate group, allowing it to participate in chemical reactions to form complex molecules.
Uses
Used in Pharmaceutical Industry:
2-METHOXYETHYL-4-AMINOCROTONATE is used as an intermediate in the synthesis of O-Desisopropyl-O-methoxyethyl Nimodipine (D290165), which is an impurity in the production of Nimodipine. Nimodipine is a dihydropyridine calcium channel blocker that functions as a vasodilator, specifically for cerebral applications. It is primarily used to improve blood flow in the brain and treat conditions such as subarachnoid hemorrhage and other related cerebrovascular disorders.
By acting as a key intermediate in the synthesis of Nimodipine, 2-METHOXYETHYL-4-AMINOCROTONATE plays a significant role in the development and production of this important medication, contributing to its therapeutic effects and potential benefits for patients suffering from cerebral vascular conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 50899-10-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,8,9 and 9 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 50899-10:
(7*5)+(6*0)+(5*8)+(4*9)+(3*9)+(2*1)+(1*0)=140
140 % 10 = 0
So 50899-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H13NO3/c1-6(8)5-7(9)11-4-3-10-2/h5H,3-4,8H2,1-2H3
