51-56-9 Usage
Description
alpha-Hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide is a complex organic compound with a unique chemical structure. It is characterized by its ester and hydrobromide functional groups, which contribute to its chemical properties and potential applications.
Uses
Used in Pharmaceutical Industry:
alpha-Hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide is used as an active pharmaceutical ingredient for the development of new drugs targeting various medical conditions. Its unique chemical structure allows for potential interactions with specific biological targets, making it a promising candidate for drug discovery and development.
Used in Chemical Research:
alpha-Hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide is also used as a research tool in the field of organic chemistry, where it can be employed to study the properties and reactivity of ester and hydrobromide functional groups. It can be used to investigate various chemical reactions and mechanisms, contributing to the advancement of chemical knowledge.
Used in Analytical Chemistry:
alpha-Hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide can be utilized as a reference compound or standard in analytical chemistry. Its unique structure and properties make it suitable for calibration and quality control purposes in various analytical techniques, such as chromatography and spectroscopy.
Used in Material Science:
alpha-Hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide may also find applications in the field of material science, where its unique chemical structure could be exploited to develop new materials with specific properties. These materials could have potential uses in various industries, such as electronics, aerospace, or automotive.
Clinical Use
Homatropine hydrobromide is used topically to paralyzethe ciliary structure of the eye (cycloplegia) and to effectmydriasis. It behaves very much like atropine but is weakerand less toxic. In the eye, it acts more rapidly but less persistentlythan atropine. Dilation of the pupil takes place inabout 15 to 20 minutes, and the action subsides in about24 hours. By using a miotic, such as physostigmine, it ispossible to restore the pupil to normality in a few hours.
Check Digit Verification of cas no
The CAS Registry Mumber 51-56-9 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 5 and 1 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 51-56:
(4*5)+(3*1)+(2*5)+(1*6)=39
39 % 10 = 9
So 51-56-9 is a valid CAS Registry Number.
InChI:InChI:1S/C16H21NO3.BrH/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11;/h2-6,12-15,18H,7-10H2,1H3;1H