5107-58-4 Usage
Description
[Benzene-1,2,4,5-tetrayltetrakis(carbonyloxy)]tetrakis[tributylstannane] is a complex chemical compound with the molecular formula C44H56O8Sn4. It is a tetrakis(carbonyloxy) derivative of benzene, featuring four tributylstannane groups attached to the benzene ring. [benzene-1,2,4,5-tetrayltetrakis(carbonyloxy)]tetrakis[tributylstannane] is known for its high reactivity and potential toxicity, necessitating careful handling and use in a controlled laboratory environment.
Uses
Used in Organic Synthesis:
[Benzene-1,2,4,5-tetrayltetrakis(carbonyloxy)]tetrakis[tributylstannane] is used as a precursor in the field of organic synthesis, particularly for the formation of organotin-containing polymers. Its unique structure and reactivity make it a valuable component in creating novel materials with specific properties.
Used in Catalyst Development:
In the chemical industry, [Benzene-1,2,4,5-tetrayltetrakis(carbonyloxy)]tetrakis[tributylstannane] is utilized as a potential catalyst or catalyst component. Its ability to facilitate various chemical reactions makes it a promising candidate for improving the efficiency and selectivity of industrial processes.
Used in Molecular Structure Construction:
[benzene-1,2,4,5-tetrayltetrakis(carbonyloxy)]tetrakis[tributylstannane] also serves as a building block for the construction of complex molecular structures. Its unique properties and reactivity allow chemists to create intricate and sophisticated molecules with potential applications in various fields, such as pharmaceuticals, materials science, and nanotechnology.
Used in the Polymer Industry:
[Benzene-1,2,4,5-tetrayltetrakis(carbonyloxy)]tetrakis[tributylstannane] is used as a key component in the development of organotin-containing polymers. These polymers exhibit unique properties, such as enhanced thermal stability, mechanical strength, and resistance to degradation, making them suitable for a range of applications, including automotive, aerospace, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 5107-58-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,0 and 7 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5107-58:
(6*5)+(5*1)+(4*0)+(3*7)+(2*5)+(1*8)=74
74 % 10 = 4
So 5107-58-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H6O8.12C4H9.4Sn/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16;12*1-3-4-2;;;;/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);12*1,3-4H2,2H3;;;;/r4C12H27Sn.C10H6O8/c4*1-4-7-10-13(11-8-5-2)12-9-6-3;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h4*4-12H2,1-3H3;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18)