51211-51-9 Usage
Description
Alpha-cyclodextrin hydrate, also known as α-cyclodextrin, is a cyclic oligosaccharide consisting of seven glucose units. It is a white crystalline powder with a unique torus-shaped structure that allows it to form inclusion complexes with a wide variety of molecules, leading to enzyme-like specificity in reactions.
Uses
Used in the Food Industry:
Alpha-cyclodextrin hydrate is used as a complexing agent in the food industry. Its ability to form inclusion complexes with various molecules helps to improve the solubility, stability, and bioavailability of certain ingredients, such as flavors, colors, and vitamins. This enhances the overall quality, taste, and shelf life of the final product.
Additionally, alpha-cyclodextrin hydrate can be used to reduce the bitterness or astringency of certain compounds, making it a valuable tool in the development of new food products with improved sensory properties.
Check Digit Verification of cas no
The CAS Registry Mumber 51211-51-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,2,1 and 1 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 51211-51:
(7*5)+(6*1)+(5*2)+(4*1)+(3*1)+(2*5)+(1*1)=69
69 % 10 = 9
So 51211-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C36H60O30/c37-1-7-25-13(43)19(49)31(55-7)62-26-8(2-38)57-33(21(51)15(26)45)64-28-10(4-40)59-35(23(53)17(28)47)66-30-12(6-42)60-36(24(54)18(30)48)65-29-11(5-41)58-34(22(52)16(29)46)63-27-9(3-39)56-32(61-25)20(50)14(27)44/h7-54H,1-6H2/t7-,8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25?,26?,27?,28?,29?,30?,31?,32?,33?,34?,35?,36?/m1/s1