51306-43-5 Usage
Type of compound
Triazole compound
Structure
Five-membered heterocyclic compound with three nitrogen atoms and two carbon atoms
Functional groups
Fluorophenyl group, carbaldehyde group
Potential applications
Pharmaceuticals, agrochemicals, and materials science
Usage
Building block for the synthesis of various organic molecules and bioactive compounds
Unique property
Presence of the fluorine atom in the phenyl ring, which may contribute to its distinct properties and applications in different fields
Check Digit Verification of cas no
The CAS Registry Mumber 51306-43-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,3,0 and 6 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 51306-43:
(7*5)+(6*1)+(5*3)+(4*0)+(3*6)+(2*4)+(1*3)=85
85 % 10 = 5
So 51306-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H6FN3O/c10-8-3-1-2-4-9(8)13-11-5-7(6-14)12-13/h1-6H