51423-20-2 Usage
Description
1-[2-[4-(2,2-Dimethyl-7-methoxy-3-phenylchroman-4-yl)phenoxy]ethyl]pyrrolidine is a complex organic compound with a unique molecular structure. It is characterized by its chroman and phenyl groups, which contribute to its potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
1-[2-[4-(2,2-Dimethyl-7-methoxy-3-phenylchroman-4-yl)phenoxy]ethyl]pyrrolidine is used as a pharmaceutical compound for its potential therapeutic properties. 1-[2-[4-(2,2-Dimethyl-7-methoxy-3-phenylchroman-4-yl)phenoxy]ethyl]pyrrolidine's unique structure may allow it to interact with specific biological targets, making it a candidate for the development of new drugs.
Used in Research and Development:
In the field of research and development, 1-[2-[4-(2,2-Dimethyl-7-methoxy-3-phenylchroman-4-yl)phenoxy]ethyl]pyrrolidine can be used as a starting material or a building block for the synthesis of more complex molecules with potential applications in various industries, such as pharmaceuticals, agrochemicals, and materials science.
Used in Chemical Synthesis:
1-[2-[4-(2,2-Dimethyl-7-methoxy-3-phenylchroman-4-yl)phenoxy]ethyl]pyrrolidine can be utilized as an intermediate in the synthesis of other organic compounds. Its unique structure may provide new opportunities for the development of novel chemical entities with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 51423-20-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,4,2 and 3 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 51423-20:
(7*5)+(6*1)+(5*4)+(4*2)+(3*3)+(2*2)+(1*0)=82
82 % 10 = 2
So 51423-20-2 is a valid CAS Registry Number.
InChI:InChI=1/C30H35NO3/c1-30(2)29(23-9-5-4-6-10-23)28(26-16-15-25(32-3)21-27(26)34-30)22-11-13-24(14-12-22)33-20-19-31-17-7-8-18-31/h4-6,9-16,21,28-29H,7-8,17-20H2,1-3H3